C17H30N2S — CID 140539591
N-(1,2-dicyclohexylethyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 140539591) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is N-(1,2-dicyclohexylethyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(1,2-dicyclohexylethyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 140539591 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-(1,2-dicyclohexylethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | C1CCC(CC(NC2=NCCS2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H30N2S/c1-3-7-14(8-4-1)13-16(15-9-5-2-6-10-15)19-17-18-11-12-20-17/h14-16H,1-13H2,(H,18,19) |
| InChIKey | BXTQYOIJXLIBKM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |