C23H47NO2 — CID 140539850
3-cyclohexyl-3-[2-(8-methylnonylamino)ethyl]pentane-1,5-diol (PubChem CID 140539850) has the molecular formula C23H47NO2 and a molecular weight of 369.63 g/mol. Its IUPAC name is 3-cyclohexyl-3-[2-(8-methylnonylamino)ethyl]pentane-1,5-diol.
| Compound Name | 3-cyclohexyl-3-[2-(8-methylnonylamino)ethyl]pentane-1,5-diol |
|---|---|
| PubChem CID | 140539850 |
| Molecular Formula | C23H47NO2 |
| Molecular Weight | 369.63 g/mol |
| Exact Mass | 369.36 |
| IUPAC Name | 3-cyclohexyl-3-[2-(8-methylnonylamino)ethyl]pentane-1,5-diol |
| SMILES | CC(C)CCCCCCCNCCC(CCO)(CCO)C1CCCCC1 |
| InChI | InChI=1S/C23H47NO2/c1-21(2)11-7-4-3-5-10-17-24-18-14-23(15-19-25,16-20-26)22-12-8-6-9-13-22/h21-22,24-26H,3-20H2,1-2H3 |
| InChIKey | UZJWLVNSHJBYFL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|