About methyl 2-(4-oxocyclohexyl)ethyl carbonate
methyl 2-(4-oxocyclohexyl)ethyl carbonate (PubChem CID 140540616) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl 2-(4-oxocyclohexyl)ethyl carbonate.
Molecular Properties
| Compound Name | methyl 2-(4-oxocyclohexyl)ethyl carbonate |
| PubChem CID | 140540616 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl 2-(4-oxocyclohexyl)ethyl carbonate |
| SMILES | COC(=O)OCCC1CCC(=O)CC1 |
| InChI | InChI=1S/C10H16O4/c1-13-10(12)14-7-6-8-2-4-9(11)5-3-8/h8H,2-7H2,1H3 |
| InChIKey | ULVJCIGAQFLNCE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(4-oxocyclohexyl)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-oxocyclohexyl)ethyl carbonate?
The IUPAC name of methyl 2-(4-oxocyclohexyl)ethyl carbonate (CID 140540616) is methyl 2-(4-oxocyclohexyl)ethyl carbonate.
What is the SMILES notation for methyl 2-(4-oxocyclohexyl)ethyl carbonate?
The canonical SMILES for methyl 2-(4-oxocyclohexyl)ethyl carbonate is COC(=O)OCCC1CCC(=O)CC1.
What is the InChIKey of methyl 2-(4-oxocyclohexyl)ethyl carbonate?
The InChIKey is ULVJCIGAQFLNCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-13-10(12)14-7-6-8-2-4-9(11)5-3-8/h8H,2-7H2,1H3.
What are the key properties of methyl 2-(4-oxocyclohexyl)ethyl carbonate?
methyl 2-(4-oxocyclohexyl)ethyl carbonate has a molecular weight of 200.23 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-oxocyclohexyl)ethyl carbonate is sourced from PubChem (CID 140540616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).