About [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea
[4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea (PubChem CID 140540677) has the molecular formula C22H33N3O2
and a molecular weight of 371.53 g/mol. Its IUPAC name is [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea.
Molecular Properties
| Compound Name | [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea |
| PubChem CID | 140540677 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea |
| SMILES | NC(=O)NC1CCC(CCN2[C@@H]3CC[C@H]2CC(O)(c2ccccc2)C3)CC1 |
| InChI | InChI=1S/C22H33N3O2/c23-21(26)24-18-8-6-16(7-9-18)12-13-25-19-10-11-20(25)15-22(27,14-19)17-4-2-1-3-5-17/h1-5,16,18-20,27H,6-15H2,(H3,23,24,26)/t16?,18?,19-,20+,22? |
| InChIKey | IDHFJCDKEWPDOK-UQHAKMKOSA-N |
| XLogP | 3.12 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea?
The IUPAC name of [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea (CID 140540677) is [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea.
What is the SMILES notation for [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea?
The canonical SMILES for [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea is NC(=O)NC1CCC(CCN2[C@@H]3CC[C@H]2CC(O)(c2ccccc2)C3)CC1.
What is the InChIKey of [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea?
The InChIKey is IDHFJCDKEWPDOK-UQHAKMKOSA-N. The full InChI is InChI=1S/C22H33N3O2/c23-21(26)24-18-8-6-16(7-9-18)12-13-25-19-10-11-20(25)15-22(27,14-19)17-4-2-1-3-5-17/h1-5,16,18-20,27H,6-15H2,(H3,23,24,26)/t16?,18?,19-,20+,22?.
What are the key properties of [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea?
[4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea has a molecular weight of 371.53 g/mol, XLogP of 3.12, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[(1R,5S)-3-hydroxy-3-phenyl-8-azabicyclo[3.2.1]octan-8-yl]ethyl]cyclohexyl]urea is sourced from PubChem (CID 140540677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).