C20H17ClF3NO3 — CID 140541149
[6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indol-4-yl] acetate (PubChem CID 140541149) has the molecular formula C20H17ClF3NO3 and a molecular weight of 411.81 g/mol. Its IUPAC name is [6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indol-4-yl] acetate.
| Compound Name | [6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indol-4-yl] acetate |
|---|---|
| PubChem CID | 140541149 |
| Molecular Formula | C20H17ClF3NO3 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indol-4-yl] acetate |
| SMILES | CC(=O)Oc1cc(Cl)cc2c1c(C)c(C)n2Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H17ClF3NO3/c1-11-12(2)25(10-14-5-4-6-16(7-14)28-20(22,23)24)17-8-15(21)9-18(19(11)17)27-13(3)26/h4-9H,10H2,1-3H3 |
| InChIKey | VPVCRMMYSDWYJZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|