C25H25ClF3NO5 — CID 140542060
(2,2,2-trifluoroacetyl) 3-[4-[4-[3-(4-chlorophenyl)propoxy]phenyl]-3,6-dihydro-2H-pyridin-1-yl]propaneperoxoate (PubChem CID 140542060) has the molecular formula C25H25ClF3NO5 and a molecular weight of 511.92 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[4-[4-[3-(4-chlorophenyl)propoxy]phenyl]-3,6-dihydro-2H-pyridin-1-yl]propaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[4-[4-[3-(4-chlorophenyl)propoxy]phenyl]-3,6-dihydro-2H-pyridin-1-yl]propaneperoxoate |
|---|---|
| PubChem CID | 140542060 |
| Molecular Formula | C25H25ClF3NO5 |
| Molecular Weight | 511.92 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[4-[4-[3-(4-chlorophenyl)propoxy]phenyl]-3,6-dihydro-2H-pyridin-1-yl]propaneperoxoate |
| SMILES | O=C(CCN1CC=C(c2ccc(OCCCc3ccc(Cl)cc3)cc2)CC1)OOC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H25ClF3NO5/c26-21-7-3-18(4-8-21)2-1-17-33-22-9-5-19(6-10-22)20-11-14-30(15-12-20)16-13-23(31)34-35-24(32)25(27,28)29/h3-11H,1-2,12-17H2 |
| InChIKey | NMUCHFFZOIUVMA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.92 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|