C20H22N6O5S — CID 140542166
3-[[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]carbamothioylamino]propanoic acid (PubChem CID 140542166) has the molecular formula C20H22N6O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-[[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]carbamothioylamino]propanoic acid.
| Compound Name | 3-[[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 140542166 |
| Molecular Formula | C20H22N6O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 3-[[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-6-yl]carbamothioylamino]propanoic acid |
| SMILES | COc1cc(Nc2cnc3ccc(NC(=S)NCCC(=O)O)nc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N6O5S/c1-29-13-8-11(9-14(30-2)18(13)31-3)23-16-10-22-12-4-5-15(24-19(12)25-16)26-20(32)21-7-6-17(27)28/h4-5,8-10H,6-7H2,1-3H3,(H,27,28)(H3,21,23,24,25,26,32) |
| InChIKey | VYGZDQNIJFFVIN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|