C4H6O10S2 — CID 140542573
4-[4-(2-hydroxyethyl)-2,2-dioxo-1,3,2-dioxathietan-4-yl]-2,2-dioxo-1,3,2-dioxathietan-4-ol (PubChem CID 140542573) has the molecular formula C4H6O10S2 and a molecular weight of 278.22 g/mol. Its IUPAC name is 4-[4-(2-hydroxyethyl)-2,2-dioxo-1,3,2-dioxathietan-4-yl]-2,2-dioxo-1,3,2-dioxathietan-4-ol.
| Compound Name | 4-[4-(2-hydroxyethyl)-2,2-dioxo-1,3,2-dioxathietan-4-yl]-2,2-dioxo-1,3,2-dioxathietan-4-ol |
|---|---|
| PubChem CID | 140542573 |
| Molecular Formula | C4H6O10S2 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 4-[4-(2-hydroxyethyl)-2,2-dioxo-1,3,2-dioxathietan-4-yl]-2,2-dioxo-1,3,2-dioxathietan-4-ol |
| SMILES | O=S1(=O)OC(O)(C2(CCO)OS(=O)(=O)O2)O1 |
| InChI | InChI=1S/C4H6O10S2/c5-2-1-3(11-15(7,8)12-3)4(6)13-16(9,10)14-4/h5-6H,1-2H2 |
| InChIKey | OSPAYWJTXKFAQS-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |