C5H5F4IN2 — CID 140543541
1-(1,1,2,2-tetrafluoroethyl)-1H-imidazol-1-ium iodide (PubChem CID 140543541) has the molecular formula C5H5F4IN2 and a molecular weight of 296.00 g/mol. Its IUPAC name is 1-(1,1,2,2-tetrafluoroethyl)-1H-imidazol-1-ium iodide.
| Compound Name | 1-(1,1,2,2-tetrafluoroethyl)-1H-imidazol-1-ium iodide |
|---|---|
| PubChem CID | 140543541 |
| Molecular Formula | C5H5F4IN2 |
| Molecular Weight | 296.00 g/mol |
| Exact Mass | 295.94 |
| IUPAC Name | 1-(1,1,2,2-tetrafluoroethyl)-1H-imidazol-1-ium iodide |
| SMILES | FC(F)C(F)(F)[NH+]1C=CN=C1.[I-] |
| InChI | InChI=1S/C5H4F4N2.HI/c6-4(7)5(8,9)11-2-1-10-3-11;/h1-4H;1H |
| InChIKey | XZEOCMUQAJCSOV-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.00 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|