C15H15ClN4O4 — CID 140544397
5-chloro-3-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid (PubChem CID 140544397) has the molecular formula C15H15ClN4O4 and a molecular weight of 350.76 g/mol. Its IUPAC name is 5-chloro-3-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid.
| Compound Name | 5-chloro-3-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 140544397 |
| Molecular Formula | C15H15ClN4O4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-chloro-3-[2-(4-methylpiperazin-1-yl)-2-oxoacetyl]-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid |
| SMILES | CN1CCN(C(=O)C(=O)c2c[nH]c3c(C(=O)O)cc(Cl)nc23)CC1 |
| InChI | InChI=1S/C15H15ClN4O4/c1-19-2-4-20(5-3-19)14(22)13(21)9-7-17-11-8(15(23)24)6-10(16)18-12(9)11/h6-7,17H,2-5H2,1H3,(H,23,24) |
| InChIKey | FSUKYSKHLMVTPM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|