C24H21N3O4 — CID 140544972
3-[1-[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyethoxy]propanenitrile (PubChem CID 140544972) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[1-[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyethoxy]propanenitrile.
| Compound Name | 3-[1-[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyethoxy]propanenitrile |
|---|---|
| PubChem CID | 140544972 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[1-[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyethoxy]propanenitrile |
| SMILES | COc1ccc(-c2c(-c3ccccc3)oc3ncnc(OC(C)OCCC#N)c23)cc1 |
| InChI | InChI=1S/C24H21N3O4/c1-16(29-14-6-13-25)30-23-21-20(17-9-11-19(28-2)12-10-17)22(18-7-4-3-5-8-18)31-24(21)27-15-26-23/h3-5,7-12,15-16H,6,14H2,1-2H3 |
| InChIKey | GOYNVIUEGXHLQI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|