About [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate
[bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate (PubChem CID 140545202) has the molecular formula C18H13F2IO3S
and a molecular weight of 474.27 g/mol. Its IUPAC name is [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate.
Molecular Properties
| Compound Name | [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate |
| PubChem CID | 140545202 |
| Molecular Formula | C18H13F2IO3S |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate |
| SMILES | O=S(=O)(OI(c1ccccc1F)c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H13F2IO3S/c19-15-10-4-6-12-17(15)21(18-13-7-5-11-16(18)20)24-25(22,23)14-8-2-1-3-9-14/h1-13H |
| InChIKey | WEPZCDAGRLLIRH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate?
The IUPAC name of [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate (CID 140545202) is [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate.
What is the SMILES notation for [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate?
The canonical SMILES for [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate is O=S(=O)(OI(c1ccccc1F)c1ccccc1F)c1ccccc1.
What is the InChIKey of [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate?
The InChIKey is WEPZCDAGRLLIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2IO3S/c19-15-10-4-6-12-17(15)21(18-13-7-5-11-16(18)20)24-25(22,23)14-8-2-1-3-9-14/h1-13H.
What are the key properties of [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate?
[bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate has a molecular weight of 474.27 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(2-fluorophenyl)-λ3-iodanyl] benzenesulfonate is sourced from PubChem (CID 140545202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).