About strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide)
strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) (PubChem CID 140545988) has the molecular formula C22H44N4Sr+2
and a molecular weight of 452.24 g/mol. Its IUPAC name is strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide).
Molecular Properties
| Compound Name | strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) |
| PubChem CID | 140545988 |
| Molecular Formula | C22H44N4Sr+2 |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) |
| SMILES | C/C(=C/C(C)=[NH+]/C(C)C)[N-]C(C)C.C/C(=C/C(C)=[NH+]/C(C)C)[N-]C(C)C.[Sr+2] |
| InChI | InChI=1S/2C11H21N2.Sr/c2*1-8(2)12-10(5)7-11(6)13-9(3)4;/h2*7-9H,1-6H3;/q2*-1;+2/p+2/b2*10-7-,13-11+; |
| InChIKey | PKODALURXOSZEB-UOJAUZAQSA-P |
| XLogP | 2.86 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide)?
The IUPAC name of strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) (CID 140545988) is strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide).
What is the SMILES notation for strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide)?
The canonical SMILES for strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) is C/C(=C/C(C)=[NH+]/C(C)C)[N-]C(C)C.C/C(=C/C(C)=[NH+]/C(C)C)[N-]C(C)C.[Sr+2].
What is the InChIKey of strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide)?
The InChIKey is PKODALURXOSZEB-UOJAUZAQSA-P. The full InChI is InChI=1S/2C11H21N2.Sr/c2*1-8(2)12-10(5)7-11(6)13-9(3)4;/h2*7-9H,1-6H3;/q2*-1;+2/p+2/b2*10-7-,13-11+;.
What are the key properties of strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide)?
strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) has a molecular weight of 452.24 g/mol, XLogP of 2.86, 8 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for strontium bis(propan-2-yl-[(Z)-4-propan-2-ylazaniumylidenepent-2-en-2-yl]azanide) is sourced from PubChem (CID 140545988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).