C17H16Cl2N4O6 — CID 140546044
7-[2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]oxy]ethyl]-1,4,10-trioxa-7-azaspiro[4.5]decane-2,3-dione (PubChem CID 140546044) has the molecular formula C17H16Cl2N4O6 and a molecular weight of 443.24 g/mol. Its IUPAC name is 7-[2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]oxy]ethyl]-1,4,10-trioxa-7-azaspiro[4.5]decane-2,3-dione.
| Compound Name | 7-[2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]oxy]ethyl]-1,4,10-trioxa-7-azaspiro[4.5]decane-2,3-dione |
|---|---|
| PubChem CID | 140546044 |
| Molecular Formula | C17H16Cl2N4O6 |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 7-[2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]oxy]ethyl]-1,4,10-trioxa-7-azaspiro[4.5]decane-2,3-dione |
| SMILES | Cc1nc(OCCN2CCOC3(C2)OC(=O)C(=O)O3)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N4O6/c1-10-20-16(21-23(10)11-2-3-12(18)13(19)8-11)26-6-4-22-5-7-27-17(9-22)28-14(24)15(25)29-17/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | ZONYAFJNDPWVRE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 105.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|