C15H20N2O4 — CID 140546531
5-tert-butyl-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione (PubChem CID 140546531) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-tert-butyl-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione.
| Compound Name | 5-tert-butyl-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140546531 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-tert-butyl-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)C1(C2C=CC3=C(C2)OCCO3)NC(=O)NC1=O |
| InChI | InChI=1S/C15H20N2O4/c1-14(2,3)15(12(18)16-13(19)17-15)9-4-5-10-11(8-9)21-7-6-20-10/h4-5,9H,6-8H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | JXIVUKQWSHHBBE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|