C32H40F6N2O6 — CID 140546534
5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione (PubChem CID 140546534) has the molecular formula C32H40F6N2O6 and a molecular weight of 662.67 g/mol. Its IUPAC name is 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140546534 |
| Molecular Formula | C32H40F6N2O6 |
| Molecular Weight | 662.67 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCN1C(=O)NC(CC)(C2C=CC3=C(C2)OCCO3)C1=O |
| InChI | InChI=1S/C32H40F6N2O6/c1-4-9-20-17-23(30(43,31(33,34)35)32(36,37)38)18-21(10-5-2)26(20)46-14-8-7-13-40-27(41)29(6-3,39-28(40)42)22-11-12-24-25(19-22)45-16-15-44-24/h11-12,17-18,22,43H,4-10,13-16,19H2,1-3H3,(H,39,42) |
| InChIKey | VAWGDETYSHHGQU-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|