C37H42F6N2O6 — CID 140546546
5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)-6-propylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione (PubChem CID 140546546) has the molecular formula C37H42F6N2O6 and a molecular weight of 724.74 g/mol. Its IUPAC name is 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)-6-propylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)-6-propylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140546546 |
| Molecular Formula | C37H42F6N2O6 |
| Molecular Weight | 724.74 g/mol |
| Exact Mass | 724.29 |
| IUPAC Name | 5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-(2-phenylethyl)-6-propylphenoxy]butyl]-5-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCc2ccccc2)c1OCCCCN1C(=O)NC(CC)(C2C=CC3=C(C2)OCCO3)C1=O |
| InChI | InChI=1S/C37H42F6N2O6/c1-3-10-25-21-28(35(48,36(38,39)40)37(41,42)43)22-26(14-13-24-11-6-5-7-12-24)31(25)51-18-9-8-17-45-32(46)34(4-2,44-33(45)47)27-15-16-29-30(23-27)50-20-19-49-29/h5-7,11-12,15-16,21-22,27,48H,3-4,8-10,13-14,17-20,23H2,1-2H3,(H,44,47) |
| InChIKey | OGNHZNFZANKXKA-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.74 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|