C12H24O3Si — CID 14054742
(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4-dihydro-2H-pyran-3-ol (PubChem CID 14054742) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 14054742 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4-dihydro-2H-pyran-3-ol |
| SMILES | C[C@H]1OC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C12H24O3Si/c1-9-11(13)10(7-8-14-9)15-16(5,6)12(2,3)4/h7-11,13H,1-6H3/t9-,10-,11-/m1/s1 |
| InChIKey | UJOBWNWTDACYCC-GMTAPVOTSA-N |
| XLogP | 2.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|