About 1-methylpiperidin-1-ium hexafluorophosphate
1-methylpiperidin-1-ium hexafluorophosphate (PubChem CID 140547735) has the molecular formula C6H14F6NP
and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-methylpiperidin-1-ium hexafluorophosphate.
Molecular Properties
| Compound Name | 1-methylpiperidin-1-ium hexafluorophosphate |
| PubChem CID | 140547735 |
| Molecular Formula | C6H14F6NP |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-methylpiperidin-1-ium hexafluorophosphate |
| SMILES | C[NH+]1CCCCC1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C6H13N.F6P/c1-7-5-3-2-4-6-7;1-7(2,3,4,5)6/h2-6H2,1H3;/q;-1/p+1 |
| InChIKey | VOTWAQMVXXXNES-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperidin-1-ium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-1-ium hexafluorophosphate?
The IUPAC name of 1-methylpiperidin-1-ium hexafluorophosphate (CID 140547735) is 1-methylpiperidin-1-ium hexafluorophosphate.
What is the SMILES notation for 1-methylpiperidin-1-ium hexafluorophosphate?
The canonical SMILES for 1-methylpiperidin-1-ium hexafluorophosphate is C[NH+]1CCCCC1.F[P-](F)(F)(F)(F)F.
What is the InChIKey of 1-methylpiperidin-1-ium hexafluorophosphate?
The InChIKey is VOTWAQMVXXXNES-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H13N.F6P/c1-7-5-3-2-4-6-7;1-7(2,3,4,5)6/h2-6H2,1H3;/q;-1/p+1.
What are the key properties of 1-methylpiperidin-1-ium hexafluorophosphate?
1-methylpiperidin-1-ium hexafluorophosphate has a molecular weight of 245.15 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-1-ium hexafluorophosphate is sourced from PubChem (CID 140547735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).