C18H27N3O9S3 — CID 140547845
1-[2,4,6-trioxo-3,5-bis[1-(2-sulfanylpropanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-sulfanylpropanoate (PubChem CID 140547845) has the molecular formula C18H27N3O9S3 and a molecular weight of 525.63 g/mol. Its IUPAC name is 1-[2,4,6-trioxo-3,5-bis[1-(2-sulfanylpropanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-sulfanylpropanoate.
| Compound Name | 1-[2,4,6-trioxo-3,5-bis[1-(2-sulfanylpropanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-sulfanylpropanoate |
|---|---|
| PubChem CID | 140547845 |
| Molecular Formula | C18H27N3O9S3 |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | 1-[2,4,6-trioxo-3,5-bis[1-(2-sulfanylpropanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 2-sulfanylpropanoate |
| SMILES | CC(S)C(=O)OC(C)n1c(=O)n(C(C)OC(=O)C(C)S)c(=O)n(C(C)OC(=O)C(C)S)c1=O |
| InChI | InChI=1S/C18H27N3O9S3/c1-7(31)13(22)28-10(4)19-16(25)20(11(5)29-14(23)8(2)32)18(27)21(17(19)26)12(6)30-15(24)9(3)33/h7-12,31-33H,1-6H3 |
| InChIKey | ZYXGCRDXAUHMQI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 144.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|