C29H53NO5SSi2 — CID 140548501
4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohex-4-en-2-yl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 140548501) has the molecular formula C29H53NO5SSi2 and a molecular weight of 583.98 g/mol. Its IUPAC name is 4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohex-4-en-2-yl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohex-4-en-2-yl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 140548501 |
| Molecular Formula | C29H53NO5SSi2 |
| Molecular Weight | 583.98 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | 4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-oxohex-4-en-2-yl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc([C@H](C)O[Si](C)(C)C(C)(C)C)cc1[C@H](C/C=C/C=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H53NO5SSi2/c1-22(2)30-36(32,33)27-18-17-24(23(3)35-38(12,13)29(7,8)9)20-26(27)25(16-14-15-19-31)21-34-37(10,11)28(4,5)6/h14-15,17-20,22-23,25,30H,16,21H2,1-13H3/b15-14+/t23-,25+/m0/s1 |
| InChIKey | XKDQABFOXWQPHU-IDMHDMBWSA-N |
| XLogP | 7.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.98 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|