C21H26N2O — CID 140548953
(4aR,8aS)-1-(3-methyl-2-pyridinyl)-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol (PubChem CID 140548953) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (4aR,8aS)-1-(3-methyl-2-pyridinyl)-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol.
| Compound Name | (4aR,8aS)-1-(3-methyl-2-pyridinyl)-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
|---|---|
| PubChem CID | 140548953 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (4aR,8aS)-1-(3-methyl-2-pyridinyl)-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
| SMILES | Cc1cccnc1N1CCC(O)(c2ccccc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H26N2O/c1-16-8-7-14-22-20(16)23-15-13-21(24,17-9-3-2-4-10-17)18-11-5-6-12-19(18)23/h2-4,7-10,14,18-19,24H,5-6,11-13,15H2,1H3/t18-,19+,21?/m1/s1 |
| InChIKey | PEDKFBFMXZQLPG-QSJYAPKHSA-N |
| XLogP | 4.05 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |