C22H30F3N3O2 — CID 140548972
[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[1-(2,2,2-trifluoroethyl)piperazin-2-yl]methanone (PubChem CID 140548972) has the molecular formula C22H30F3N3O2 and a molecular weight of 425.50 g/mol. Its IUPAC name is [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[1-(2,2,2-trifluoroethyl)piperazin-2-yl]methanone.
| Compound Name | [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[1-(2,2,2-trifluoroethyl)piperazin-2-yl]methanone |
|---|---|
| PubChem CID | 140548972 |
| Molecular Formula | C22H30F3N3O2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[1-(2,2,2-trifluoroethyl)piperazin-2-yl]methanone |
| SMILES | O=C(C1CNCCN1CC(F)(F)F)N1CCC(O)(c2ccccc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H30F3N3O2/c23-22(24,25)15-27-13-11-26-14-19(27)20(29)28-12-10-21(30,16-6-2-1-3-7-16)17-8-4-5-9-18(17)28/h1-3,6-7,17-19,26,30H,4-5,8-15H2/t17-,18+,19?,21?/m1/s1 |
| InChIKey | JSZXVJDAYLNTSB-JJYICEPISA-N |
| XLogP | 2.50 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |