C17H31N4O5P — CID 140549641
N-(6-azido-4-diethoxyphosphoryl-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide (PubChem CID 140549641) has the molecular formula C17H31N4O5P and a molecular weight of 402.43 g/mol. Its IUPAC name is N-(6-azido-4-diethoxyphosphoryl-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide.
| Compound Name | N-(6-azido-4-diethoxyphosphoryl-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide |
|---|---|
| PubChem CID | 140549641 |
| Molecular Formula | C17H31N4O5P |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-(6-azido-4-diethoxyphosphoryl-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide |
| SMILES | CCOP(=O)(OCC)C1=CC(OC(CC)CC)C(NC(C)=O)C(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C17H31N4O5P/c1-6-13(7-2)26-16-11-14(27(23,24-8-3)25-9-4)10-15(20-21-18)17(16)19-12(5)22/h11,13,15-17H,6-10H2,1-5H3,(H,19,22) |
| InChIKey | VOTUJRYIRDXPLW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|