C19H36N2O3 — CID 140551041
cyclohexylmethyl N-[2-(4,6-dimethylheptanoylamino)ethyl]carbamate (PubChem CID 140551041) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is cyclohexylmethyl N-[2-(4,6-dimethylheptanoylamino)ethyl]carbamate.
| Compound Name | cyclohexylmethyl N-[2-(4,6-dimethylheptanoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 140551041 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | cyclohexylmethyl N-[2-(4,6-dimethylheptanoylamino)ethyl]carbamate |
| SMILES | CC(C)CC(C)CCC(=O)NCCNC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C19H36N2O3/c1-15(2)13-16(3)9-10-18(22)20-11-12-21-19(23)24-14-17-7-5-4-6-8-17/h15-17H,4-14H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | DNYNEQWJJBJALJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|