C7H5ClF2O2S — CID 140551108
3-chloro-1,2-difluoro-4-methylsulfonylbenzene (PubChem CID 140551108) has the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. Its IUPAC name is 3-chloro-1,2-difluoro-4-methylsulfonylbenzene.
| Compound Name | 3-chloro-1,2-difluoro-4-methylsulfonylbenzene |
|---|---|
| PubChem CID | 140551108 |
| Molecular Formula | C7H5ClF2O2S |
| Molecular Weight | 226.63 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | 3-chloro-1,2-difluoro-4-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C7H5ClF2O2S/c1-13(11,12)5-3-2-4(9)7(10)6(5)8/h2-3H,1H3 |
| InChIKey | DGKSURADRCGEJT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.63 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|