About [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone
[(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone (PubChem CID 140551134) has the molecular formula C29H27O2P
and a molecular weight of 438.51 g/mol. Its IUPAC name is [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone.
Molecular Properties
| Compound Name | [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone |
| PubChem CID | 140551134 |
| Molecular Formula | C29H27O2P |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone |
| SMILES | Cc1c(Cc2ccccc2)cc(P(=O)(C(=O)c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C29H27O2P/c1-21-22(2)26(19-24-13-7-4-8-14-24)20-28(23(21)3)32(31,27-17-11-6-12-18-27)29(30)25-15-9-5-10-16-25/h4-18,20H,19H2,1-3H3 |
| InChIKey | WSOAMPDAKNBTOH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone?
The IUPAC name of [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone (CID 140551134) is [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone.
What is the SMILES notation for [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone?
The canonical SMILES for [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone is Cc1c(Cc2ccccc2)cc(P(=O)(C(=O)c2ccccc2)c2ccccc2)c(C)c1C.
What is the InChIKey of [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone?
The InChIKey is WSOAMPDAKNBTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27O2P/c1-21-22(2)26(19-24-13-7-4-8-14-24)20-28(23(21)3)32(31,27-17-11-6-12-18-27)29(30)25-15-9-5-10-16-25/h4-18,20H,19H2,1-3H3.
What are the key properties of [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone?
[(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone has a molecular weight of 438.51 g/mol, XLogP of 6.36, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone is sourced from PubChem (CID 140551134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).