C29H27O2P — CID 140551134
[(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone (PubChem CID 140551134) has the molecular formula C29H27O2P and a molecular weight of 438.51 g/mol. Its IUPAC name is [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone.
| Compound Name | [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone |
|---|---|
| PubChem CID | 140551134 |
| Molecular Formula | C29H27O2P |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [(5-benzyl-2,3,4-trimethylphenyl)-phenylphosphoryl]-phenylmethanone |
| SMILES | Cc1c(Cc2ccccc2)cc(P(=O)(C(=O)c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C29H27O2P/c1-21-22(2)26(19-24-13-7-4-8-14-24)20-28(23(21)3)32(31,27-17-11-6-12-18-27)29(30)25-15-9-5-10-16-25/h4-18,20H,19H2,1-3H3 |
| InChIKey | WSOAMPDAKNBTOH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|