About 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid
3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid (PubChem CID 140551938) has the molecular formula C19H13ClF2N2O4
and a molecular weight of 406.77 g/mol. Its IUPAC name is 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid |
| PubChem CID | 140551938 |
| Molecular Formula | C19H13ClF2N2O4 |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2cnc(OCc3ccc(F)cc3F)c(Cl)c2=O)c1 |
| InChI | InChI=1S/C19H13ClF2N2O4/c20-16-17(28-9-13-4-5-14(21)7-15(13)22)23-10-24(18(16)25)8-11-2-1-3-12(6-11)19(26)27/h1-7,10H,8-9H2,(H,26,27) |
| InChIKey | RRMZBQQRCJOBOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid?
The IUPAC name of 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid (CID 140551938) is 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid.
What is the SMILES notation for 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid?
The canonical SMILES for 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid is O=C(O)c1cccc(Cn2cnc(OCc3ccc(F)cc3F)c(Cl)c2=O)c1.
What is the InChIKey of 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid?
The InChIKey is RRMZBQQRCJOBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClF2N2O4/c20-16-17(28-9-13-4-5-14(21)7-15(13)22)23-10-24(18(16)25)8-11-2-1-3-12(6-11)19(26)27/h1-7,10H,8-9H2,(H,26,27).
What are the key properties of 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid?
3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid has a molecular weight of 406.77 g/mol, XLogP of 3.50, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxopyrimidin-1-yl]methyl]benzoic acid is sourced from PubChem (CID 140551938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).