C16H18Cl2N6S2 — CID 140551986
N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine;dihydrochloride (PubChem CID 140551986) has the molecular formula C16H18Cl2N6S2 and a molecular weight of 429.40 g/mol. Its IUPAC name is N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 140551986 |
| Molecular Formula | C16H18Cl2N6S2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.c1csc(-c2cn[nH]c2NCCNc2[nH]ncc2-c2cccs2)c1 |
| InChI | InChI=1S/C16H16N6S2.2ClH/c1-3-13(23-7-1)11-9-19-21-15(11)17-5-6-18-16-12(10-20-22-16)14-4-2-8-24-14;;/h1-4,7-10H,5-6H2,(H2,17,19,21)(H2,18,20,22);2*1H |
| InChIKey | CPRWPIIHPQNZNX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|