About (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine
(3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine (PubChem CID 140552044) has the molecular formula C34H31N3
and a molecular weight of 481.64 g/mol. Its IUPAC name is (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine.
Molecular Properties
| Compound Name | (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine |
| PubChem CID | 140552044 |
| Molecular Formula | C34H31N3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine |
| SMILES | CCNc1ccc2c(c1)/C(=C/c1cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn1)CC2 |
| InChI | InChI=1S/C34H31N3/c1-2-35-31-21-20-26-18-19-27(33(26)23-31)22-32-24-37(25-36-32)34(28-12-6-3-7-13-28,29-14-8-4-9-15-29)30-16-10-5-11-17-30/h3-17,20-25,35H,2,18-19H2,1H3/b27-22+ |
| InChIKey | MFBLDMFHOHYTNS-HPNDGRJYSA-N |
| XLogP | 7.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine?
The IUPAC name of (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine (CID 140552044) is (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine.
What is the SMILES notation for (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine?
The canonical SMILES for (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine is CCNc1ccc2c(c1)/C(=C/c1cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn1)CC2.
What is the InChIKey of (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine?
The InChIKey is MFBLDMFHOHYTNS-HPNDGRJYSA-N. The full InChI is InChI=1S/C34H31N3/c1-2-35-31-21-20-26-18-19-27(33(26)23-31)22-32-24-37(25-36-32)34(28-12-6-3-7-13-28,29-14-8-4-9-15-29)30-16-10-5-11-17-30/h3-17,20-25,35H,2,18-19H2,1H3/b27-22+.
What are the key properties of (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine?
(3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine has a molecular weight of 481.64 g/mol, XLogP of 7.64, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-ethyl-3-[(1-tritylimidazol-4-yl)methylidene]-1,2-dihydroinden-5-amine is sourced from PubChem (CID 140552044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).