About N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide
N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide (PubChem CID 140552221) has the molecular formula C27H21N3OS2
and a molecular weight of 467.62 g/mol. Its IUPAC name is N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 140552221 |
| Molecular Formula | C27H21N3OS2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide |
| SMILES | N#CCNC(=O)c1ncsc1/C=C\SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21N3OS2/c28-17-18-29-26(31)25-24(32-20-30-25)16-19-33-27(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-16,19-20H,18H2,(H,29,31)/b19-16- |
| InChIKey | KBLDJIHBKGKEKF-MNDPQUGUSA-N |
| XLogP | 6.09 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide (CID 140552221) is N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide is N#CCNC(=O)c1ncsc1/C=C\SC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide?
The InChIKey is KBLDJIHBKGKEKF-MNDPQUGUSA-N. The full InChI is InChI=1S/C27H21N3OS2/c28-17-18-29-26(31)25-24(32-20-30-25)16-19-33-27(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-16,19-20H,18H2,(H,29,31)/b19-16-.
What are the key properties of N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide?
N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide has a molecular weight of 467.62 g/mol, XLogP of 6.09, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-5-[(Z)-2-tritylsulfanylethenyl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 140552221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).