C22H15ClF3N3O4 — CID 140552391
4-chloro-5-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxy-N-(2-methoxyphenyl)-N-methylbenzamide (PubChem CID 140552391) has the molecular formula C22H15ClF3N3O4 and a molecular weight of 477.83 g/mol. Its IUPAC name is 4-chloro-5-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxy-N-(2-methoxyphenyl)-N-methylbenzamide.
| Compound Name | 4-chloro-5-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxy-N-(2-methoxyphenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 140552391 |
| Molecular Formula | C22H15ClF3N3O4 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 4-chloro-5-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]-2,3-dihydroxy-N-(2-methoxyphenyl)-N-methylbenzamide |
| SMILES | COc1ccccc1N(C)C(=O)c1cc(-c2cnc(C(F)(F)F)cc2C#N)c(Cl)c(O)c1O |
| InChI | InChI=1S/C22H15ClF3N3O4/c1-29(15-5-3-4-6-16(15)33-2)21(32)13-8-12(18(23)20(31)19(13)30)14-10-28-17(22(24,25)26)7-11(14)9-27/h3-8,10,30-31H,1-2H3 |
| InChIKey | ACBKVCHPSPJSJP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|