About N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide
N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide (PubChem CID 140552918) has the molecular formula C20H18N4O3S
and a molecular weight of 394.46 g/mol. Its IUPAC name is N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide.
Molecular Properties
| Compound Name | N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide |
| PubChem CID | 140552918 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide |
| SMILES | C=Cc1ccc(NNC(=O)c2cscn2)cc1NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H18N4O3S/c1-3-13-4-7-15(23-24-20(26)18-11-28-12-21-18)10-17(13)22-19(25)14-5-8-16(27-2)9-6-14/h3-12,23H,1H2,2H3,(H,22,25)(H,24,26) |
| InChIKey | RPUFFKSUWMDYIB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide?
The IUPAC name of N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide (CID 140552918) is N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide.
What is the SMILES notation for N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide?
The canonical SMILES for N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide is C=Cc1ccc(NNC(=O)c2cscn2)cc1NC(=O)c1ccc(OC)cc1.
What is the InChIKey of N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide?
The InChIKey is RPUFFKSUWMDYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3S/c1-3-13-4-7-15(23-24-20(26)18-11-28-12-21-18)10-17(13)22-19(25)14-5-8-16(27-2)9-6-14/h3-12,23H,1H2,2H3,(H,22,25)(H,24,26).
What are the key properties of N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide?
N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide has a molecular weight of 394.46 g/mol, XLogP of 3.80, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-ethenyl-5-[2-(1,3-thiazole-4-carbonyl)hydrazinyl]phenyl]-4-methoxybenzamide is sourced from PubChem (CID 140552918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).