C26H25F6NO2S — CID 140553232
(4R)-4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-methyl-5-phenylpentane-2-sulfinamide (PubChem CID 140553232) has the molecular formula C26H25F6NO2S and a molecular weight of 529.55 g/mol. Its IUPAC name is (4R)-4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-methyl-5-phenylpentane-2-sulfinamide.
| Compound Name | (4R)-4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-methyl-5-phenylpentane-2-sulfinamide |
|---|---|
| PubChem CID | 140553232 |
| Molecular Formula | C26H25F6NO2S |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | (4R)-4-(4-fluorophenyl)-4-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-methyl-5-phenylpentane-2-sulfinamide |
| SMILES | CC(C)(C[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1)S(N)=O |
| InChI | InChI=1S/C26H25F6NO2S/c1-24(2,36(33)34)16-25(15-17-6-4-3-5-7-17,18-8-10-20(27)11-9-18)19-12-21(28)14-22(13-19)35-26(31,32)23(29)30/h3-14,23H,15-16,33H2,1-2H3/t25-,36?/m1/s1 |
| InChIKey | WACKXYXBGWOKRV-NNHKGWTCSA-N |
| XLogP | 6.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|