C21H34OS — CID 140553847
(1Z,3E,5E,7E,9E)-2-(sulfanylmethyl)icosa-1,3,5,7,9-pentaen-1-ol (PubChem CID 140553847) has the molecular formula C21H34OS and a molecular weight of 334.57 g/mol. Its IUPAC name is (1Z,3E,5E,7E,9E)-2-(sulfanylmethyl)icosa-1,3,5,7,9-pentaen-1-ol.
| Compound Name | (1Z,3E,5E,7E,9E)-2-(sulfanylmethyl)icosa-1,3,5,7,9-pentaen-1-ol |
|---|---|
| PubChem CID | 140553847 |
| Molecular Formula | C21H34OS |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (1Z,3E,5E,7E,9E)-2-(sulfanylmethyl)icosa-1,3,5,7,9-pentaen-1-ol |
| SMILES | CCCCCCCCCC/C=C/C=C/C=C/C=C/C(=C/O)CS |
| InChI | InChI=1S/C21H34OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(19-22)20-23/h11-19,22-23H,2-10,20H2,1H3/b12-11+,14-13+,16-15+,18-17+,21-19- |
| InChIKey | XYOYBLDZNGETPK-JBZYKCJKSA-N |
| XLogP | 7.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|