About (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate
(6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate (PubChem CID 140554494) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate.
Molecular Properties
| Compound Name | (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate |
| PubChem CID | 140554494 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate |
| SMILES | C=CCC1=CC(OC)C(OC(=O)Cc2ccccc2)C=C1 |
| InChI | InChI=1S/C18H20O3/c1-3-7-14-10-11-16(17(12-14)20-2)21-18(19)13-15-8-5-4-6-9-15/h3-6,8-12,16-17H,1,7,13H2,2H3 |
| InChIKey | GYNGHSUJADAKMP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate?
The IUPAC name of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate (CID 140554494) is (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate.
What is the SMILES notation for (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate?
The canonical SMILES for (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate is C=CCC1=CC(OC)C(OC(=O)Cc2ccccc2)C=C1.
What is the InChIKey of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate?
The InChIKey is GYNGHSUJADAKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3/c1-3-7-14-10-11-16(17(12-14)20-2)21-18(19)13-15-8-5-4-6-9-15/h3-6,8-12,16-17H,1,7,13H2,2H3.
What are the key properties of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate?
(6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate has a molecular weight of 284.36 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) 2-phenylacetate is sourced from PubChem (CID 140554494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).