About (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate
(6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate (PubChem CID 140554499) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate.
Molecular Properties
| Compound Name | (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate |
| PubChem CID | 140554499 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate |
| SMILES | C=CCC1=CC(OC)C(OC(=O)CCCCCC)C=C1 |
| InChI | InChI=1S/C17H26O3/c1-4-6-7-8-10-17(18)20-15-12-11-14(9-5-2)13-16(15)19-3/h5,11-13,15-16H,2,4,6-10H2,1,3H3 |
| InChIKey | YYVFEOLFKKOLBF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate?
The IUPAC name of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate (CID 140554499) is (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate.
What is the SMILES notation for (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate?
The canonical SMILES for (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate is C=CCC1=CC(OC)C(OC(=O)CCCCCC)C=C1.
What is the InChIKey of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate?
The InChIKey is YYVFEOLFKKOLBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c1-4-6-7-8-10-17(18)20-15-12-11-14(9-5-2)13-16(15)19-3/h5,11-13,15-16H,2,4,6-10H2,1,3H3.
What are the key properties of (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate?
(6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate has a molecular weight of 278.39 g/mol, XLogP of 3.96, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-4-prop-2-enylcyclohexa-2,4-dien-1-yl) heptanoate is sourced from PubChem (CID 140554499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).