About 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate
1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate (PubChem CID 140556133) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate |
| PubChem CID | 140556133 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate |
| SMILES | CC(=CO)C(=O)OC12CCC(C1)C1CCCC12 |
| InChI | InChI=1S/C14H20O3/c1-9(8-15)13(16)17-14-6-5-10(7-14)11-3-2-4-12(11)14/h8,10-12,15H,2-7H2,1H3 |
| InChIKey | DOWQHZYTDNEOFJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate?
The IUPAC name of 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate (CID 140556133) is 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate.
What is the SMILES notation for 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate?
The canonical SMILES for 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate is CC(=CO)C(=O)OC12CCC(C1)C1CCCC12.
What is the InChIKey of 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate?
The InChIKey is DOWQHZYTDNEOFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-9(8-15)13(16)17-14-6-5-10(7-14)11-3-2-4-12(11)14/h8,10-12,15H,2-7H2,1H3.
What are the key properties of 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate?
1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate has a molecular weight of 236.31 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tricyclo[5.2.1.02,6]decanyl 3-hydroxy-2-methylprop-2-enoate is sourced from PubChem (CID 140556133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).