C27H27F2N5O — CID 140556884
N-[amino-[5-[(3,5-difluorophenyl)methyl]-2H-indazol-3-yl]-piperidin-1-ylmethyl]benzamide (PubChem CID 140556884) has the molecular formula C27H27F2N5O and a molecular weight of 475.54 g/mol. Its IUPAC name is N-[amino-[5-[(3,5-difluorophenyl)methyl]-2H-indazol-3-yl]-piperidin-1-ylmethyl]benzamide.
| Compound Name | N-[amino-[5-[(3,5-difluorophenyl)methyl]-2H-indazol-3-yl]-piperidin-1-ylmethyl]benzamide |
|---|---|
| PubChem CID | 140556884 |
| Molecular Formula | C27H27F2N5O |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-[amino-[5-[(3,5-difluorophenyl)methyl]-2H-indazol-3-yl]-piperidin-1-ylmethyl]benzamide |
| SMILES | NC(NC(=O)c1ccccc1)(c1[nH]nc2ccc(Cc3cc(F)cc(F)c3)cc12)N1CCCCC1 |
| InChI | InChI=1S/C27H27F2N5O/c28-21-14-19(15-22(29)17-21)13-18-9-10-24-23(16-18)25(33-32-24)27(30,34-11-5-2-6-12-34)31-26(35)20-7-3-1-4-8-20/h1,3-4,7-10,14-17H,2,5-6,11-13,30H2,(H,31,35)(H,32,33) |
| InChIKey | UGRMVCDZTPZVGN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|