C20H32O14 — CID 140557629
2-ethenyl-1,6-bis[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,6-dione (PubChem CID 140557629) has the molecular formula C20H32O14 and a molecular weight of 496.46 g/mol. Its IUPAC name is 2-ethenyl-1,6-bis[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,6-dione.
| Compound Name | 2-ethenyl-1,6-bis[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,6-dione |
|---|---|
| PubChem CID | 140557629 |
| Molecular Formula | C20H32O14 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-ethenyl-1,6-bis[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexane-1,6-dione |
| SMILES | C=CC(CCCC(=O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H32O14/c1-2-8(16(28)20(32)18(30)15(27)13(25)10(7-22)34-20)4-3-5-11(23)19(31)17(29)14(26)12(24)9(6-21)33-19/h2,8-10,12-15,17-18,21-22,24-27,29-32H,1,3-7H2/t8?,9-,10-,12-,13-,14+,15+,17-,18-,19?,20?/m1/s1 |
| InChIKey | VVBXWAGMFMQKSC-PMBIDMJBSA-N |
| XLogP | -5.58 |
| TPSA | 254.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | -5.58 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|