C23H27N3O4 — CID 140558790
4-[2-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-propan-2-ylamino]methyl]phenyl]ethynyl]benzamide (PubChem CID 140558790) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-[2-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-propan-2-ylamino]methyl]phenyl]ethynyl]benzamide.
| Compound Name | 4-[2-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-propan-2-ylamino]methyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 140558790 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-[2-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-propan-2-ylamino]methyl]phenyl]ethynyl]benzamide |
| SMILES | CC(C)N(Cc1ccc(C#Cc2ccc(C(N)=O)cc2)cc1)[C@H](C(=O)NO)[C@@H](C)O |
| InChI | InChI=1S/C23H27N3O4/c1-15(2)26(21(16(3)27)23(29)25-30)14-19-8-6-17(7-9-19)4-5-18-10-12-20(13-11-18)22(24)28/h6-13,15-16,21,27,30H,14H2,1-3H3,(H2,24,28)(H,25,29)/t16-,21+/m1/s1 |
| InChIKey | UCBLXPUNCLYIEB-IERDGZPVSA-N |
| XLogP | 1.65 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|