About 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-)
2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) (PubChem CID 140559041) has the molecular formula C15H17LiNO-
and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-).
Molecular Properties
| Compound Name | 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) |
| PubChem CID | 140559041 |
| Molecular Formula | C15H17LiNO- |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) |
| SMILES | Cc1ccc(/[NH+]=C/c2ccccc2[O-])c(C)c1.[LiH2-] |
| InChI | InChI=1S/C15H15NO.Li.2H/c1-11-7-8-14(12(2)9-11)16-10-13-5-3-4-6-15(13)17;;;/h3-10,17H,1-2H3;;;/q;-1;;/b16-10+;;; |
| InChIKey | AQHPJNBPQBRCOE-BCSAYTTPSA-N |
| XLogP | 0.29 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-)?
The IUPAC name of 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) (CID 140559041) is 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-).
What is the SMILES notation for 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-)?
The canonical SMILES for 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) is Cc1ccc(/[NH+]=C/c2ccccc2[O-])c(C)c1.[LiH2-].
What is the InChIKey of 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-)?
The InChIKey is AQHPJNBPQBRCOE-BCSAYTTPSA-N. The full InChI is InChI=1S/C15H15NO.Li.2H/c1-11-7-8-14(12(2)9-11)16-10-13-5-3-4-6-15(13)17;;;/h3-10,17H,1-2H3;;;/q;-1;;/b16-10+;;;.
What are the key properties of 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-)?
2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) has a molecular weight of 234.25 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethylphenyl)azaniumylidenemethyl]phenolate;lithium(1-) is sourced from PubChem (CID 140559041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).