About lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate
lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate (PubChem CID 140559057) has the molecular formula C14H15LiNO-
and a molecular weight of 220.22 g/mol. Its IUPAC name is lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate.
Molecular Properties
| Compound Name | lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate |
| PubChem CID | 140559057 |
| Molecular Formula | C14H15LiNO- |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate |
| SMILES | Cc1cccc(/[NH+]=C/c2ccccc2[O-])c1.[LiH2-] |
| InChI | InChI=1S/C14H13NO.Li.2H/c1-11-5-4-7-13(9-11)15-10-12-6-2-3-8-14(12)16;;;/h2-10,16H,1H3;;;/q;-1;;/b15-10+;;; |
| InChIKey | GTUUXSQFVICPLH-RJQKUYQSSA-N |
| XLogP | -0.02 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate?
The IUPAC name of lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate (CID 140559057) is lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate.
What is the SMILES notation for lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate?
The canonical SMILES for lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate is Cc1cccc(/[NH+]=C/c2ccccc2[O-])c1.[LiH2-].
What is the InChIKey of lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate?
The InChIKey is GTUUXSQFVICPLH-RJQKUYQSSA-N. The full InChI is InChI=1S/C14H13NO.Li.2H/c1-11-5-4-7-13(9-11)15-10-12-6-2-3-8-14(12)16;;;/h2-10,16H,1H3;;;/q;-1;;/b15-10+;;;.
What are the key properties of lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate?
lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate has a molecular weight of 220.22 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium(1-);2-[(3-methylphenyl)azaniumylidenemethyl]phenolate is sourced from PubChem (CID 140559057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).