C14H20Br2N2O2 — CID 140559244
6-bromo-2-(5-bromo-2-hydroxycyclohexyl)-4a,5,6,7,8,8a-hexahydro-3H-quinazolin-4-one (PubChem CID 140559244) has the molecular formula C14H20Br2N2O2 and a molecular weight of 408.13 g/mol. Its IUPAC name is 6-bromo-2-(5-bromo-2-hydroxycyclohexyl)-4a,5,6,7,8,8a-hexahydro-3H-quinazolin-4-one.
| Compound Name | 6-bromo-2-(5-bromo-2-hydroxycyclohexyl)-4a,5,6,7,8,8a-hexahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 140559244 |
| Molecular Formula | C14H20Br2N2O2 |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 6-bromo-2-(5-bromo-2-hydroxycyclohexyl)-4a,5,6,7,8,8a-hexahydro-3H-quinazolin-4-one |
| SMILES | O=C1NC(C2CC(Br)CCC2O)=NC2CCC(Br)CC12 |
| InChI | InChI=1S/C14H20Br2N2O2/c15-7-1-3-11-9(5-7)14(20)18-13(17-11)10-6-8(16)2-4-12(10)19/h7-12,19H,1-6H2,(H,17,18,20) |
| InChIKey | SYRALCPNINIZCG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|