C11H9F3N4O2 — CID 140559705
2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-5-yl 2,2,2-trifluoroacetate (PubChem CID 140559705) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-5-yl 2,2,2-trifluoroacetate.
| Compound Name | 2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-5-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140559705 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraen-5-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cc2nc3c(cn2n1)CCNC3)C(F)(F)F |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)10(19)20-9-3-8-16-7-4-15-2-1-6(7)5-18(8)17-9/h3,5,15H,1-2,4H2 |
| InChIKey | WGGCBBDCCUYNCZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |