C24H21ClF5N5OS — CID 140560276
4-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1,2-thiazol-3-amine (PubChem CID 140560276) has the molecular formula C24H21ClF5N5OS and a molecular weight of 557.98 g/mol. Its IUPAC name is 4-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1,2-thiazol-3-amine.
| Compound Name | 4-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 140560276 |
| Molecular Formula | C24H21ClF5N5OS |
| Molecular Weight | 557.98 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | 4-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1,2-thiazol-3-amine |
| SMILES | Cc1ncn(-c2ccc(Nc3nscc3C(CCCCCl)c3ccc(OC(F)(F)F)c(F)c3)cc2F)n1 |
| InChI | InChI=1S/C24H21ClF5N5OS/c1-14-31-13-35(33-14)21-7-6-16(11-19(21)26)32-23-18(12-37-34-23)17(4-2-3-9-25)15-5-8-22(20(27)10-15)36-24(28,29)30/h5-8,10-13,17H,2-4,9H2,1H3,(H,32,34) |
| InChIKey | AMZCSOYJWVTOIL-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.98 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|