C33H59FO6Si2 — CID 140560526
(4S,7R,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-13-fluoro-5,5,7,9-tetramethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 140560526) has the molecular formula C33H59FO6Si2 and a molecular weight of 627.00 g/mol. Its IUPAC name is (4S,7R,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-13-fluoro-5,5,7,9-tetramethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-13-fluoro-5,5,7,9-tetramethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 140560526 |
| Molecular Formula | C33H59FO6Si2 |
| Molecular Weight | 627.00 g/mol |
| Exact Mass | 626.38 |
| IUPAC Name | (4S,7R,9S,10E,13E,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-13-fluoro-5,5,7,9-tetramethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(=O)O[C@H](C(C)=O)C/C=C(/F)C/C=C/[C@H](C)C(O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C1(C)C |
| InChI | InChI=1S/C33H59FO6Si2/c1-14-42(15-2,16-3)39-28-22-29(36)38-27(25(6)35)21-20-26(34)19-17-18-23(4)30(24(5)31(37)33(28,10)11)40-41(12,13)32(7,8)9/h17-18,20,23-24,27-28,30H,14-16,19,21-22H2,1-13H3/b18-17+,26-20+/t23-,24+,27-,28-,30?/m0/s1 |
| InChIKey | LRIAOWNRFCLQJT-DGZOTWSGSA-N |
| XLogP | 8.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.00 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|