C43H82O6P2 — CID 140560656
3,9-bis[(2-tert-butyl-4-nonylcyclohexyl)oxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 140560656) has the molecular formula C43H82O6P2 and a molecular weight of 757.07 g/mol. Its IUPAC name is 3,9-bis[(2-tert-butyl-4-nonylcyclohexyl)oxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis[(2-tert-butyl-4-nonylcyclohexyl)oxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 140560656 |
| Molecular Formula | C43H82O6P2 |
| Molecular Weight | 757.07 g/mol |
| Exact Mass | 756.56 |
| IUPAC Name | 3,9-bis[(2-tert-butyl-4-nonylcyclohexyl)oxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CCCCCCCCCC1CCC(OP2OCC3(CO2)COP(OC2CCC(CCCCCCCCC)CC2C(C)(C)C)OC3)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C43H82O6P2/c1-9-11-13-15-17-19-21-23-35-25-27-39(37(29-35)41(3,4)5)48-50-44-31-43(32-45-50)33-46-51(47-34-43)49-40-28-26-36(30-38(40)42(6,7)8)24-22-20-18-16-14-12-10-2/h35-40H,9-34H2,1-8H3 |
| InChIKey | FXDFUAPEBKUMIW-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.07 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|