C24H27N3O6 — CID 140560913
(4S)-5-[2-ethyl-4-[5-(4-formyl-3-methylphenyl)-1,2,4-oxadiazol-3-yl]-6-methylphenoxy]-2,4-dihydroxypentanamide (PubChem CID 140560913) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is (4S)-5-[2-ethyl-4-[5-(4-formyl-3-methylphenyl)-1,2,4-oxadiazol-3-yl]-6-methylphenoxy]-2,4-dihydroxypentanamide.
| Compound Name | (4S)-5-[2-ethyl-4-[5-(4-formyl-3-methylphenyl)-1,2,4-oxadiazol-3-yl]-6-methylphenoxy]-2,4-dihydroxypentanamide |
|---|---|
| PubChem CID | 140560913 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (4S)-5-[2-ethyl-4-[5-(4-formyl-3-methylphenyl)-1,2,4-oxadiazol-3-yl]-6-methylphenoxy]-2,4-dihydroxypentanamide |
| SMILES | CCc1cc(-c2noc(-c3ccc(C=O)c(C)c3)n2)cc(C)c1OC[C@@H](O)CC(O)C(N)=O |
| InChI | InChI=1S/C24H27N3O6/c1-4-15-9-18(8-14(3)21(15)32-12-19(29)10-20(30)22(25)31)23-26-24(33-27-23)16-5-6-17(11-28)13(2)7-16/h5-9,11,19-20,29-30H,4,10,12H2,1-3H3,(H2,25,31)/t19-,20?/m0/s1 |
| InChIKey | LWHOFAPQKQIWAH-XJDOXCRVSA-N |
| XLogP | 2.37 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|