C23H28O7 — CID 140560981
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[8-(4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxane-2,3,4,5-tetrol (PubChem CID 140560981) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[8-(4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[8-(4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140560981 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[8-(4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxane-2,3,4,5-tetrol |
| SMILES | COc1ccc(C2CCCc3ccc([C@@]4(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc32)cc1 |
| InChI | InChI=1S/C23H28O7/c1-29-16-9-6-14(7-10-16)17-4-2-3-13-5-8-15(11-18(13)17)23(28)22(27)21(26)20(25)19(12-24)30-23/h5-11,17,19-22,24-28H,2-4,12H2,1H3/t17?,19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | HIIWQVXIFROHBD-MXKXIPCASA-N |
| XLogP | 0.78 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |